About propylurea
propylurea (PubChem CID 12303) has the molecular formula C4H10N2O
and a molecular weight of 102.14 g/mol. Its IUPAC name is propylurea.
Molecular Properties
| Compound Name | propylurea |
| PubChem CID | 12303 |
| Molecular Formula | C4H10N2O |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.08 |
| IUPAC Name | propylurea |
| SMILES | CCCNC(N)=O |
| InChI | InChI=1S/C4H10N2O/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
| InChIKey | ZQZJKHIIQFPZCS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylurea?
The IUPAC name of propylurea (CID 12303) is propylurea.
What is the SMILES notation for propylurea?
The canonical SMILES for propylurea is CCCNC(N)=O.
What is the InChIKey of propylurea?
The InChIKey is ZQZJKHIIQFPZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7).
What are the key properties of propylurea?
propylurea has a molecular weight of 102.14 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propylurea is sourced from PubChem (CID 12303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).