About stilbene azide
stilbene azide (PubChem CID 159769295) has the molecular formula C14H12N3-
and a molecular weight of 222.27 g/mol. Its IUPAC name is stilbene azide.
Molecular Properties
| Compound Name | stilbene azide |
| PubChem CID | 159769295 |
| Molecular Formula | C14H12N3- |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | stilbene azide |
| SMILES | C(=Cc1ccccc1)c1ccccc1.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C14H12.N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-2/h1-12H;/q;-1 |
| InChIKey | NFXGPHVXLJWKDK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze stilbene azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stilbene azide?
The IUPAC name of stilbene azide (CID 159769295) is stilbene azide.
What is the SMILES notation for stilbene azide?
The canonical SMILES for stilbene azide is C(=Cc1ccccc1)c1ccccc1.[N-]=[N+]=[N-].
What is the InChIKey of stilbene azide?
The InChIKey is NFXGPHVXLJWKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.N3/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-3-2/h1-12H;/q;-1.
What are the key properties of stilbene azide?
stilbene azide has a molecular weight of 222.27 g/mol, XLogP of 4.72, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for stilbene azide is sourced from PubChem (CID 159769295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).