C13H15N5O3 — CID 5380
View drug profile → tazanolastbutyl 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetate (PubChem CID 5380) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is butyl 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetate.
| Compound Name | butyl 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetate |
|---|---|
| PubChem CID | 5380 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | butyl 2-oxo-2-[3-(2H-tetrazol-5-yl)anilino]acetate |
| SMILES | CCCCOC(=O)C(=O)Nc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C13H15N5O3/c1-2-3-7-21-13(20)12(19)14-10-6-4-5-9(8-10)11-15-17-18-16-11/h4-6,8H,2-3,7H2,1H3,(H,14,19)(H,15,16,17,18) |
| InChIKey | XQTARQNQIVVBRX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|