About 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea (PubChem CID 7547) has the molecular formula C13H9Cl3N2O
and a molecular weight of 315.59 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 7547 |
| Molecular Formula | C13H9Cl3N2O |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| InChIKey | ICUTUKXCWQYESQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea?
The IUPAC name of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea (CID 7547) is 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea is O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea?
The InChIKey is ICUTUKXCWQYESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19).
What are the key properties of 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea?
1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea has a molecular weight of 315.59 g/mol, XLogP of 5.29, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 7547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).