About undec-3-en-3-amine
undec-3-en-3-amine (PubChem CID 151904505) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is undec-3-en-3-amine.
Molecular Properties
| Compound Name | undec-3-en-3-amine |
| PubChem CID | 151904505 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | undec-3-en-3-amine |
| SMILES | CCCCCCCC=C(N)CC |
| InChI | InChI=1S/C11H23N/c1-3-5-6-7-8-9-10-11(12)4-2/h10H,3-9,12H2,1-2H3 |
| InChIKey | STLLSAUNOXPADJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze undec-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of undec-3-en-3-amine?
The IUPAC name of undec-3-en-3-amine (CID 151904505) is undec-3-en-3-amine.
What is the SMILES notation for undec-3-en-3-amine?
The canonical SMILES for undec-3-en-3-amine is CCCCCCCC=C(N)CC.
What is the InChIKey of undec-3-en-3-amine?
The InChIKey is STLLSAUNOXPADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-3-5-6-7-8-9-10-11(12)4-2/h10H,3-9,12H2,1-2H3.
What are the key properties of undec-3-en-3-amine?
undec-3-en-3-amine has a molecular weight of 169.31 g/mol, XLogP of 3.60, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for undec-3-en-3-amine is sourced from PubChem (CID 151904505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).