C17H13F5O4S — CID 10001476
(1R,5R,6R)-6-[(2R,3S)-3-methyloxiran-2-yl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbothioyloxymethyl]bicyclo[3.1.0]hexan-2-one (PubChem CID 10001476) has the molecular formula C17H13F5O4S and a molecular weight of 408.34 g/mol. Its IUPAC name is (1R,5R,6R)-6-[(2R,3S)-3-methyloxiran-2-yl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbothioyloxymethyl]bicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,5R,6R)-6-[(2R,3S)-3-methyloxiran-2-yl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbothioyloxymethyl]bicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10001476 |
| Molecular Formula | C17H13F5O4S |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | (1R,5R,6R)-6-[(2R,3S)-3-methyloxiran-2-yl]-1-[(2,3,4,5,6-pentafluorophenoxy)carbothioyloxymethyl]bicyclo[3.1.0]hexan-2-one |
| SMILES | C[C@@H]1O[C@@H]1[C@@H]1[C@H]2CCC(=O)[C@@]12COC(=S)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H13F5O4S/c1-5-14(25-5)8-6-2-3-7(23)17(6,8)4-24-16(27)26-15-12(21)10(19)9(18)11(20)13(15)22/h5-6,8,14H,2-4H2,1H3/t5-,6+,8-,14-,17-/m0/s1 |
| InChIKey | JDEPNELPYHRGSU-XHYGKVSSSA-N |
| XLogP | 3.44 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|