C20H24F4O4 — CID 58498480
(1,2,2,6,6-pentamethyl-4-oxocyclohexyl)methyl (2,3,4,6-tetrafluoro-5-methylphenyl) carbonate (PubChem CID 58498480) has the molecular formula C20H24F4O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethyl-4-oxocyclohexyl)methyl (2,3,4,6-tetrafluoro-5-methylphenyl) carbonate.
| Compound Name | (1,2,2,6,6-pentamethyl-4-oxocyclohexyl)methyl (2,3,4,6-tetrafluoro-5-methylphenyl) carbonate |
|---|---|
| PubChem CID | 58498480 |
| Molecular Formula | C20H24F4O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (1,2,2,6,6-pentamethyl-4-oxocyclohexyl)methyl (2,3,4,6-tetrafluoro-5-methylphenyl) carbonate |
| SMILES | Cc1c(F)c(F)c(F)c(OC(=O)OCC2(C)C(C)(C)CC(=O)CC2(C)C)c1F |
| InChI | InChI=1S/C20H24F4O4/c1-10-12(21)14(23)15(24)16(13(10)22)28-17(26)27-9-20(6)18(2,3)7-11(25)8-19(20,4)5/h7-9H2,1-6H3 |
| InChIKey | PEQBBDFKLHKQGL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|