C15H15F5O6 — CID 58498496
[2-(methoxymethyl)-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)carbonyloxypropyl] acetate (PubChem CID 58498496) has the molecular formula C15H15F5O6 and a molecular weight of 386.27 g/mol. Its IUPAC name is [2-(methoxymethyl)-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)carbonyloxypropyl] acetate.
| Compound Name | [2-(methoxymethyl)-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)carbonyloxypropyl] acetate |
|---|---|
| PubChem CID | 58498496 |
| Molecular Formula | C15H15F5O6 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-(methoxymethyl)-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)carbonyloxypropyl] acetate |
| SMILES | COCC(C)(COC(C)=O)COC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H15F5O6/c1-7(21)24-5-15(2,4-23-3)6-25-14(22)26-13-11(19)9(17)8(16)10(18)12(13)20/h4-6H2,1-3H3 |
| InChIKey | HEPIMZNAICKAQI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|