C15H11F5N2O4S — CID 10001582
2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxyacetamide (PubChem CID 10001582) has the molecular formula C15H11F5N2O4S and a molecular weight of 410.32 g/mol. Its IUPAC name is 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10001582 |
| Molecular Formula | C15H11F5N2O4S |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxyacetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)NO |
| InChI | InChI=1S/C15H11F5N2O4S/c16-10-11(17)13(19)15(14(20)12(10)18)27(25,26)22(7-9(23)21-24)6-8-4-2-1-3-5-8/h1-5,24H,6-7H2,(H,21,23) |
| InChIKey | HNXQLWUITFQYPE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|