C16H13F5N2O4S — CID 23645529
2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 23645529) has the molecular formula C16H13F5N2O4S and a molecular weight of 424.35 g/mol. Its IUPAC name is 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 23645529 |
| Molecular Formula | C16H13F5N2O4S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | CC(C(=O)NO)N(Cc1ccccc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H13F5N2O4S/c1-8(16(24)22-25)23(7-9-5-3-2-4-6-9)28(26,27)15-13(20)11(18)10(17)12(19)14(15)21/h2-6,8,25H,7H2,1H3,(H,22,24) |
| InChIKey | SNYKGOMEURTYMK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|