C18H17F5N2O4S — CID 23645530
2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 23645530) has the molecular formula C18H17F5N2O4S and a molecular weight of 452.40 g/mol. Its IUPAC name is 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 23645530 |
| Molecular Formula | C18H17F5N2O4S |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-[benzyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NO)N(Cc1ccccc1)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H17F5N2O4S/c1-9(2)16(18(26)24-27)25(8-10-6-4-3-5-7-10)30(28,29)17-14(22)12(20)11(19)13(21)15(17)23/h3-7,9,16,27H,8H2,1-2H3,(H,24,26) |
| InChIKey | XFNJKSWXHKYCFN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|