C20H30O9 — CID 10001825
2-hydroxy-4-(4-nonyl-3-oxofuran-2-yl)butane-1,2,3-tricarboxylic acid (PubChem CID 10001825) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-hydroxy-4-(4-nonyl-3-oxofuran-2-yl)butane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-4-(4-nonyl-3-oxofuran-2-yl)butane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 10001825 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 2-hydroxy-4-(4-nonyl-3-oxofuran-2-yl)butane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCCC1=COC(CC(C(=O)O)C(O)(CC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C20H30O9/c1-2-3-4-5-6-7-8-9-13-12-29-15(17(13)23)10-14(18(24)25)20(28,19(26)27)11-16(21)22/h12,14-15,28H,2-11H2,1H3,(H,21,22)(H,24,25)(H,26,27) |
| InChIKey | SVFJZNSJQDBIRB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|