C30H33N2O2PSi — CID 10006633
[(1,3-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl)-(4-methylphenyl)methoxy]-triphenylsilane (PubChem CID 10006633) has the molecular formula C30H33N2O2PSi and a molecular weight of 512.67 g/mol. Its IUPAC name is [(1,3-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl)-(4-methylphenyl)methoxy]-triphenylsilane.
| Compound Name | [(1,3-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl)-(4-methylphenyl)methoxy]-triphenylsilane |
|---|---|
| PubChem CID | 10006633 |
| Molecular Formula | C30H33N2O2PSi |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | [(1,3-dimethyl-2-oxo-1,3,2λ5-diazaphospholidin-2-yl)-(4-methylphenyl)methoxy]-triphenylsilane |
| SMILES | Cc1ccc(C(O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)P2(=O)N(C)CCN2C)cc1 |
| InChI | InChI=1S/C30H33N2O2PSi/c1-25-19-21-26(22-20-25)30(35(33)31(2)23-24-32(35)3)34-36(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,30H,23-24H2,1-3H3 |
| InChIKey | GJAMVRWQGBGFCL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|