C16H22O4S — CID 10018289
[(1S)-1-[(1R,2R,4S,6S)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]ethyl] 4-methylbenzenesulfonate (PubChem CID 10018289) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is [(1S)-1-[(1R,2R,4S,6S)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]ethyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-1-[(1R,2R,4S,6S)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10018289 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [(1S)-1-[(1R,2R,4S,6S)-6-hydroxy-2-bicyclo[2.2.1]heptanyl]ethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](C)[C@@H]2C[C@@H]3C[C@H]2[C@@H](O)C3)cc1 |
| InChI | InChI=1S/C16H22O4S/c1-10-3-5-13(6-4-10)21(18,19)20-11(2)14-7-12-8-15(14)16(17)9-12/h3-6,11-12,14-17H,7-9H2,1-2H3/t11-,12+,14-,15+,16-/m0/s1 |
| InChIKey | CXUYJSLXGDZSBZ-FSNAAORZSA-N |
| XLogP | 2.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|