C19H24O4Si — CID 10020403
4,4-dimethyl-5-trimethylsilyloxy-5,8,8a,10a-tetrahydroanthracene-1,9,10-trione (PubChem CID 10020403) has the molecular formula C19H24O4Si and a molecular weight of 344.48 g/mol. Its IUPAC name is 4,4-dimethyl-5-trimethylsilyloxy-5,8,8a,10a-tetrahydroanthracene-1,9,10-trione.
| Compound Name | 4,4-dimethyl-5-trimethylsilyloxy-5,8,8a,10a-tetrahydroanthracene-1,9,10-trione |
|---|---|
| PubChem CID | 10020403 |
| Molecular Formula | C19H24O4Si |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4,4-dimethyl-5-trimethylsilyloxy-5,8,8a,10a-tetrahydroanthracene-1,9,10-trione |
| SMILES | CC1(C)C=CC(=O)C2=C1C(=O)C1C(O[Si](C)(C)C)C=CCC1C2=O |
| InChI | InChI=1S/C19H24O4Si/c1-19(2)10-9-12(20)15-16(19)18(22)14-11(17(15)21)7-6-8-13(14)23-24(3,4)5/h6,8-11,13-14H,7H2,1-5H3 |
| InChIKey | ZGSJYEFBWDTOAN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|