C21H34O5Si — CID 10883751
methyl (2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,2-trimethyl-4,8-dioxo-2,3,5,8a-tetrahydronaphthalene-4a-carboxylate (PubChem CID 10883751) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is methyl (2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,2-trimethyl-4,8-dioxo-2,3,5,8a-tetrahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,2-trimethyl-4,8-dioxo-2,3,5,8a-tetrahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10883751 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | methyl (2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,2-trimethyl-4,8-dioxo-2,3,5,8a-tetrahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C[C@@H](C)C(C)(C)[C@H]1C(=O)C=C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O5Si/c1-13-12-15(23)21(18(24)25-7)16(26-27(8,9)19(2,3)4)11-10-14(22)17(21)20(13,5)6/h10-11,13,16-17H,12H2,1-9H3/t13-,16-,17-,21-/m1/s1 |
| InChIKey | AAHJCYCXVFEONK-TXRZWFJJSA-N |
| XLogP | 3.93 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|