C30H50O6Si — CID 102253837
dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2,8-trimethyl-7-oxo-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate (PubChem CID 102253837) has the molecular formula C30H50O6Si and a molecular weight of 534.81 g/mol. Its IUPAC name is dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2,8-trimethyl-7-oxo-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate.
| Compound Name | dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2,8-trimethyl-7-oxo-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 102253837 |
| Molecular Formula | C30H50O6Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | dimethyl (1R,2R,4R,4aS,4bS,8R,8aS,10aS)-4-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-1,2,8-trimethyl-7-oxo-3,4,4a,4b,8a,9,10,10a-octahydro-2H-phenanthrene-1,8-dicarboxylate |
| SMILES | CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@@H](C)[C@@](C)(C(=O)OC)[C@H]2CC[C@H]3[C@@H](C=CC(=O)[C@]3(C)C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C30H50O6Si/c1-12-23(36-37(10,11)28(3,4)5)20-17-18(2)29(6,26(32)34-8)22-15-14-21-19(25(20)22)13-16-24(31)30(21,7)27(33)35-9/h13,16,18-23,25H,12,14-15,17H2,1-11H3/t18-,19-,20+,21+,22+,23?,25-,29-,30-/m1/s1 |
| InChIKey | TWPNCFMVQXSKDR-NUJCTUOUSA-N |
| XLogP | 6.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|