C30H50O6Si — CID 10347066
methyl (E,3R)-7-[(1R,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoate (PubChem CID 10347066) has the molecular formula C30H50O6Si and a molecular weight of 534.81 g/mol. Its IUPAC name is methyl (E,3R)-7-[(1R,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoate.
| Compound Name | methyl (E,3R)-7-[(1R,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoate |
|---|---|
| PubChem CID | 10347066 |
| Molecular Formula | C30H50O6Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | methyl (E,3R)-7-[(1R,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxohept-6-enoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C[C@@H]2C=CC[C@H](/C=C/C(=O)C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C30H50O6Si/c1-10-21(3)29(33)35-26-17-20(2)16-23-13-11-12-22(28(23)26)14-15-24(31)18-25(19-27(32)34-7)36-37(8,9)30(4,5)6/h11,13-15,20-23,25-26,28H,10,12,16-19H2,1-9H3/b15-14+/t20-,21-,22+,23-,25+,26-,28+/m0/s1 |
| InChIKey | INIPJZTXNXOGQQ-PQFWWMDHSA-N |
| XLogP | 6.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|