C20H34O4Si — CID 10666618
methyl (2R,4aS,5S,6S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxo-2,3,4a,5,6,8a-hexahydro-1H-naphthalene-2-carboxylate (PubChem CID 10666618) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is methyl (2R,4aS,5S,6S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxo-2,3,4a,5,6,8a-hexahydro-1H-naphthalene-2-carboxylate.
| Compound Name | methyl (2R,4aS,5S,6S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxo-2,3,4a,5,6,8a-hexahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 10666618 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (2R,4aS,5S,6S,8aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methyl-4-oxo-2,3,4a,5,6,8a-hexahydro-1H-naphthalene-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C)C=C[C@H]2C1 |
| InChI | InChI=1S/C20H34O4Si/c1-13-8-9-14-10-15(19(22)23-5)11-17(21)18(14)16(13)12-24-25(6,7)20(2,3)4/h8-9,13-16,18H,10-12H2,1-7H3/t13-,14-,15+,16-,18-/m0/s1 |
| InChIKey | VHRCKKFCRVSQQY-RPUYLAQPSA-N |
| XLogP | 4.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|