C17H22F2N2Si2 — CID 10020691
1-(3,5-difluoro-4-pyridin-3-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 10020691) has the molecular formula C17H22F2N2Si2 and a molecular weight of 348.55 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-pyridin-3-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-(3,5-difluoro-4-pyridin-3-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 10020691 |
| Molecular Formula | C17H22F2N2Si2 |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-(3,5-difluoro-4-pyridin-3-ylphenyl)-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1c1cc(F)c(-c2cccnc2)c(F)c1 |
| InChI | InChI=1S/C17H22F2N2Si2/c1-22(2)8-9-23(3,4)21(22)14-10-15(18)17(16(19)11-14)13-6-5-7-20-12-13/h5-7,10-12H,8-9H2,1-4H3 |
| InChIKey | HRQOXQRQDORMAC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|