C20H28O4Si — CID 10021452
(2R,5Z,9S,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-2-methoxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyne-10,11-diol (PubChem CID 10021452) has the molecular formula C20H28O4Si and a molecular weight of 360.53 g/mol. Its IUPAC name is (2R,5Z,9S,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-2-methoxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyne-10,11-diol.
| Compound Name | (2R,5Z,9S,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-2-methoxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyne-10,11-diol |
|---|---|
| PubChem CID | 10021452 |
| Molecular Formula | C20H28O4Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (2R,5Z,9S,10S,11S)-9-[tert-butyl(dimethyl)silyl]oxy-2-methoxybicyclo[7.3.1]trideca-1(12),5-dien-3,7-diyne-10,11-diol |
| SMILES | CO[C@H]1C#C/C=C\C#C[C@@]2(O[Si](C)(C)C(C)(C)C)CC1=C[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C20H28O4Si/c1-19(2,3)25(5,6)24-20-12-10-8-7-9-11-17(23-4)15(14-20)13-16(21)18(20)22/h7-8,13,16-18,21-22H,14H2,1-6H3/b8-7-/t16-,17-,18-,20+/m0/s1 |
| InChIKey | WOSVIQZLWZOMPR-MTBVTADASA-N |
| XLogP | 2.39 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|