C19H26O5S — CID 10021824
(1S,6R,9S,12S)-12-(benzenesulfonyl)-9-propyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane (PubChem CID 10021824) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is (1S,6R,9S,12S)-12-(benzenesulfonyl)-9-propyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane.
| Compound Name | (1S,6R,9S,12S)-12-(benzenesulfonyl)-9-propyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
|---|---|
| PubChem CID | 10021824 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (1S,6R,9S,12S)-12-(benzenesulfonyl)-9-propyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
| SMILES | CCC[C@@]12CC[C@H]3CCCC[C@@]3(OO1)[C@H](S(=O)(=O)c1ccccc1)O2 |
| InChI | InChI=1S/C19H26O5S/c1-2-12-18-14-11-15-8-6-7-13-19(15,24-23-18)17(22-18)25(20,21)16-9-4-3-5-10-16/h3-5,9-10,15,17H,2,6-8,11-14H2,1H3/t15-,17+,18+,19+/m1/s1 |
| InChIKey | XMDQEAQXHLPUIH-BVBHFADKSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|