C19H32O6Si — CID 10022925
methyl (1R,4S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-7-(4-hydroxybutyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate (PubChem CID 10022925) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is methyl (1R,4S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-7-(4-hydroxybutyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate.
| Compound Name | methyl (1R,4S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-7-(4-hydroxybutyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate |
|---|---|
| PubChem CID | 10022925 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl (1R,4S,7S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-7-(4-hydroxybutyl)-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]12C=C[C@@H](OC1=O)[C@H](CCCCO)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O6Si/c1-18(2,3)26(5,6)25-15-13(9-7-8-12-20)14-10-11-19(15,16(21)23-4)17(22)24-14/h10-11,13-15,20H,7-9,12H2,1-6H3/t13-,14+,15-,19-/m0/s1 |
| InChIKey | FXSZCNIIPNYLJA-YGTYGHESSA-N |
| XLogP | 2.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|