C21H27N3O5 — CID 10023991
1-O-ethyl 7-O-methyl (2E)-2-(4-oxo-2-propan-2-ylquinazolin-3-yl)iminoheptanedioate (PubChem CID 10023991) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (2E)-2-(4-oxo-2-propan-2-ylquinazolin-3-yl)iminoheptanedioate.
| Compound Name | 1-O-ethyl 7-O-methyl (2E)-2-(4-oxo-2-propan-2-ylquinazolin-3-yl)iminoheptanedioate |
|---|---|
| PubChem CID | 10023991 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (2E)-2-(4-oxo-2-propan-2-ylquinazolin-3-yl)iminoheptanedioate |
| SMILES | CCOC(=O)/C(CCCCC(=O)OC)=N/n1c(C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H27N3O5/c1-5-29-21(27)17(12-8-9-13-18(25)28-4)23-24-19(14(2)3)22-16-11-7-6-10-15(16)20(24)26/h6-7,10-11,14H,5,8-9,12-13H2,1-4H3/b23-17+ |
| InChIKey | WNXAXEKLJWOVNL-HAVVHWLPSA-N |
| XLogP | 3.02 |
| TPSA | 99.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|