C21H23ClO4S — CID 10024340
[(3aR,5S,6R,6aR)-2,2-dimethyl-5-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-benzylideneoxidanium chloride (PubChem CID 10024340) has the molecular formula C21H23ClO4S and a molecular weight of 406.93 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-5-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-benzylideneoxidanium chloride.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-5-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-benzylideneoxidanium chloride |
|---|---|
| PubChem CID | 10024340 |
| Molecular Formula | C21H23ClO4S |
| Molecular Weight | 406.93 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-5-(phenylsulfanylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-benzylideneoxidanium chloride |
| SMILES | CC1(C)O[C@H]2O[C@H](CSc3ccccc3)[C@H](/[O+]=C/c3ccccc3)[C@H]2O1.[Cl-] |
| InChI | InChI=1S/C21H23O4S.ClH/c1-21(2)24-19-18(22-13-15-9-5-3-6-10-15)17(23-20(19)25-21)14-26-16-11-7-4-8-12-16;/h3-13,17-20H,14H2,1-2H3;1H/q+1;/p-1/t17-,18+,19-,20-;/m1./s1 |
| InChIKey | CRBVLAPEHJTNAK-BOJUQBCTSA-M |
| XLogP | 1.08 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.93 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|