C22H35O5P — CID 10024553
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylpentan-2-one (PubChem CID 10024553) has the molecular formula C22H35O5P and a molecular weight of 410.49 g/mol. Its IUPAC name is (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylpentan-2-one.
| Compound Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylpentan-2-one |
|---|---|
| PubChem CID | 10024553 |
| Molecular Formula | C22H35O5P |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylpentan-2-one |
| SMILES | CC/C(=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C22H35O5P/c1-10-16(19(23)14-28(25,26-8)27-9)11-15-12-17(21(2,3)4)20(24)18(13-15)22(5,6)7/h11-13,24H,10,14H2,1-9H3/b16-11+ |
| InChIKey | KKNSADAGDCYUPN-LFIBNONCSA-N |
| XLogP | 5.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|