About (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one (PubChem CID 11743861) has the molecular formula C24H39O5P
and a molecular weight of 438.55 g/mol. Its IUPAC name is (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one.
Molecular Properties
| Compound Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one |
| PubChem CID | 11743861 |
| Molecular Formula | C24H39O5P |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one |
| SMILES | CCCC/C(=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C24H39O5P/c1-10-11-12-18(21(25)16-30(27,28-8)29-9)13-17-14-19(23(2,3)4)22(26)20(15-17)24(5,6)7/h13-15,26H,10-12,16H2,1-9H3/b18-13+ |
| InChIKey | ITRKXBSOKHKUNW-QGOAFFKASA-N |
| XLogP | 6.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one?
The IUPAC name of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one (CID 11743861) is (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one.
What is the SMILES notation for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one?
The canonical SMILES for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one is CCCC/C(=C\c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)CP(=O)(OC)OC.
What is the InChIKey of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one?
The InChIKey is ITRKXBSOKHKUNW-QGOAFFKASA-N. The full InChI is InChI=1S/C24H39O5P/c1-10-11-12-18(21(25)16-30(27,28-8)29-9)13-17-14-19(23(2,3)4)22(26)20(15-17)24(5,6)7/h13-15,26H,10-12,16H2,1-9H3/b18-13+.
What are the key properties of (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one?
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one has a molecular weight of 438.55 g/mol, XLogP of 6.62, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-dimethoxyphosphorylheptan-2-one is sourced from PubChem (CID 11743861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).