C25H26N8O — CID 10026989
4-N-[6-(5-phenylmethoxybenzimidazol-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine (PubChem CID 10026989) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is 4-N-[6-(5-phenylmethoxybenzimidazol-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[6-(5-phenylmethoxybenzimidazol-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 10026989 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-N-[6-(5-phenylmethoxybenzimidazol-1-yl)-7H-purin-2-yl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2nc(-n3cnc4cc(OCc5ccccc5)ccc43)c3[nH]cnc3n2)CC1 |
| InChI | InChI=1S/C25H26N8O/c26-17-6-8-18(9-7-17)30-25-31-23-22(27-14-28-23)24(32-25)33-15-29-20-12-19(10-11-21(20)33)34-13-16-4-2-1-3-5-16/h1-5,10-12,14-15,17-18H,6-9,13,26H2,(H2,27,28,30,31,32) |
| InChIKey | IWDJLFCNVXOKRW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |