C21H27BrO4S — CID 10027029
(1R,4S,5R,8R,10S,12S,13R)-9-bromo-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10027029) has the molecular formula C21H27BrO4S and a molecular weight of 455.41 g/mol. Its IUPAC name is (1R,4S,5R,8R,10S,12S,13R)-9-bromo-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8R,10S,12S,13R)-9-bromo-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10027029 |
| Molecular Formula | C21H27BrO4S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (1R,4S,5R,8R,10S,12S,13R)-9-bromo-1,5,9-trimethyl-10-phenylsulfanyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2C(C)(Br)[C@H](Sc3ccccc3)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C21H27BrO4S/c1-13-9-10-16-20(3,22)18(27-14-7-5-4-6-8-14)23-17-21(16)15(13)11-12-19(2,24-17)25-26-21/h4-8,13,15-18H,9-12H2,1-3H3/t13-,15+,16+,17-,18+,19-,20?,21-/m1/s1 |
| InChIKey | YKZPLJYIEYAHCW-MEAXTLGESA-N |
| XLogP | 5.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|