C25H31NO5S — CID 10027125
[(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(4-methylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2S)-2-hydroxy-2-phenylacetate (PubChem CID 10027125) has the molecular formula C25H31NO5S and a molecular weight of 457.59 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(4-methylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2S)-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(4-methylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2S)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 10027125 |
| Molecular Formula | C25H31NO5S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(4-methylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2S)-2-hydroxy-2-phenylacetate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2[C@H]3CC[C@@](C)([C@@H]2OC(=O)[C@@H](O)c2ccccc2)C3(C)C)cc1 |
| InChI | InChI=1S/C25H31NO5S/c1-16-10-12-18(13-11-16)32(29,30)26-20-19-14-15-25(4,24(19,2)3)22(20)31-23(28)21(27)17-8-6-5-7-9-17/h5-13,19-22,26-27H,14-15H2,1-4H3/t19-,20-,21+,22-,25+/m1/s1 |
| InChIKey | ZFOREGINZQTIHQ-ILJOYBHNSA-N |
| XLogP | 3.74 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |