C27H35NO5S — CID 10368120
[(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2R)-2-hydroxy-2-phenylacetate (PubChem CID 10368120) has the molecular formula C27H35NO5S and a molecular weight of 485.65 g/mol. Its IUPAC name is [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2R)-2-hydroxy-2-phenylacetate.
| Compound Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2R)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 10368120 |
| Molecular Formula | C27H35NO5S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(1R,2S,3R,4S)-1,7,7-trimethyl-3-[(2,4,6-trimethylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl] (2R)-2-hydroxy-2-phenylacetate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H]2[C@H]3CC[C@@](C)([C@@H]2OC(=O)[C@H](O)c2ccccc2)C3(C)C)c(C)c1 |
| InChI | InChI=1S/C27H35NO5S/c1-16-14-17(2)23(18(3)15-16)34(31,32)28-21-20-12-13-27(6,26(20,4)5)24(21)33-25(30)22(29)19-10-8-7-9-11-19/h7-11,14-15,20-22,24,28-29H,12-13H2,1-6H3/t20-,21-,22-,24-,27+/m1/s1 |
| InChIKey | WDMZCUHTBHSDOD-DRAARCLTSA-N |
| XLogP | 4.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |