C37H51NO7S — CID 10985165
[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-2,4,6-trimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-(1,3-dioxolan-2-yl)-7-methyl-3-oxooctanoate (PubChem CID 10985165) has the molecular formula C37H51NO7S and a molecular weight of 653.88 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-2,4,6-trimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-(1,3-dioxolan-2-yl)-7-methyl-3-oxooctanoate.
| Compound Name | [(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-2,4,6-trimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-(1,3-dioxolan-2-yl)-7-methyl-3-oxooctanoate |
|---|---|
| PubChem CID | 10985165 |
| Molecular Formula | C37H51NO7S |
| Molecular Weight | 653.88 g/mol |
| Exact Mass | 653.34 |
| IUPAC Name | [(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-2,4,6-trimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-(1,3-dioxolan-2-yl)-7-methyl-3-oxooctanoate |
| SMILES | Cc1cc(C)c(N([C@H]2[C@H]3CC[C@@](C)([C@H]2OC(=O)CC(=O)CCC(C(C)C)C2OCCO2)C3(C)C)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C37H51NO7S/c1-23(2)29(35-43-18-19-44-35)15-14-27(39)22-31(40)45-34-33(30-16-17-37(34,8)36(30,6)7)38(32-25(4)20-24(3)21-26(32)5)46(41,42)28-12-10-9-11-13-28/h9-13,20-21,23,29-30,33-35H,14-19,22H2,1-8H3/t29?,30-,33+,34+,37+/m1/s1 |
| InChIKey | AWPMECZBIFERFU-MFVQSTIXSA-N |
| XLogP | 6.93 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.88 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|