C32H39NO5S — CID 11238169
trans-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1S,2S)-2-ethenyl-5-oxocyclopentane-1-carboxylate (PubChem CID 11238169) has the molecular formula C32H39NO5S and a molecular weight of 549.73 g/mol. Its IUPAC name is trans-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1S,2S)-2-ethenyl-5-oxocyclopentane-1-carboxylate.
| Compound Name | trans-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1S,2S)-2-ethenyl-5-oxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11238169 |
| Molecular Formula | C32H39NO5S |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | trans-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (1S,2S)-2-ethenyl-5-oxocyclopentane-1-carboxylate |
| SMILES | C=C[C@@H]1CCC(=O)[C@H]1C(=O)O[C@H]1[C@@H](N(c2cc(C)cc(C)c2)S(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C32H39NO5S/c1-7-22-13-14-26(34)27(22)30(35)38-29-28(25-15-16-32(29,6)31(25,4)5)33(23-18-20(2)17-21(3)19-23)39(36,37)24-11-9-8-10-12-24/h7-12,17-19,22,25,27-29H,1,13-16H2,2-6H3/t22-,25-,27+,28+,29+,32+/m1/s1 |
| InChIKey | RBBMLKOTVPPXCR-SMKMXURVSA-N |
| XLogP | 6.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|