C31H39NO6S — CID 11226674
1-O-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-O-methyl (E)-hex-2-enedioate (PubChem CID 11226674) has the molecular formula C31H39NO6S and a molecular weight of 553.72 g/mol. Its IUPAC name is 1-O-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-O-methyl (E)-hex-2-enedioate.
| Compound Name | 1-O-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-O-methyl (E)-hex-2-enedioate |
|---|---|
| PubChem CID | 11226674 |
| Molecular Formula | C31H39NO6S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 1-O-[(1R,2R,3S,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 6-O-methyl (E)-hex-2-enedioate |
| SMILES | COC(=O)CC/C=C/C(=O)O[C@H]1[C@@H](N(c2cc(C)cc(C)c2)S(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C31H39NO6S/c1-21-18-22(2)20-23(19-21)32(39(35,36)24-12-8-7-9-13-24)28-25-16-17-31(5,30(25,3)4)29(28)38-27(34)15-11-10-14-26(33)37-6/h7-9,11-13,15,18-20,25,28-29H,10,14,16-17H2,1-6H3/b15-11+/t25-,28+,29+,31+/m1/s1 |
| InChIKey | SXHDNNDDRPOHOB-LDBKIWOISA-N |
| XLogP | 5.74 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|