C32H40N2O7S — CID 11284820
1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O-ethyl 2-acetylaziridine-1,2-dicarboxylate (PubChem CID 11284820) has the molecular formula C32H40N2O7S and a molecular weight of 596.75 g/mol. Its IUPAC name is 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O-ethyl 2-acetylaziridine-1,2-dicarboxylate.
| Compound Name | 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O-ethyl 2-acetylaziridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11284820 |
| Molecular Formula | C32H40N2O7S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O-ethyl 2-acetylaziridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)CN1C(=O)O[C@@H]1[C@H](N(c2cc(C)cc(C)c2)S(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C32H40N2O7S/c1-8-40-28(36)32(22(4)35)19-33(32)29(37)41-27-26(25-14-15-31(27,7)30(25,5)6)34(23-17-20(2)16-21(3)18-23)42(38,39)24-12-10-9-11-13-24/h9-13,16-18,25-27H,8,14-15,19H2,1-7H3/t25-,26-,27-,31+,32?,33?/m1/s1 |
| InChIKey | WMLALDBFJRRCHP-RNPAQPMQSA-N |
| XLogP | 5.04 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|