C34H42N2O7S — CID 101191921
6-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 7-O-ethyl 5-oxo-1-azabicyclo[4.1.0]heptane-6,7-dicarboxylate (PubChem CID 101191921) has the molecular formula C34H42N2O7S and a molecular weight of 622.78 g/mol. Its IUPAC name is 6-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 7-O-ethyl 5-oxo-1-azabicyclo[4.1.0]heptane-6,7-dicarboxylate.
| Compound Name | 6-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 7-O-ethyl 5-oxo-1-azabicyclo[4.1.0]heptane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 101191921 |
| Molecular Formula | C34H42N2O7S |
| Molecular Weight | 622.78 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 6-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 7-O-ethyl 5-oxo-1-azabicyclo[4.1.0]heptane-6,7-dicarboxylate |
| SMILES | CCOC(=O)C1N2CCCC(=O)C12C(=O)O[C@@H]1[C@H](N(c2cc(C)cc(C)c2)S(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C34H42N2O7S/c1-7-42-30(38)28-34(26(37)14-11-17-35(28)34)31(39)43-29-27(25-15-16-33(29,6)32(25,4)5)36(23-19-21(2)18-22(3)20-23)44(40,41)24-12-9-8-10-13-24/h8-10,12-13,18-20,25,27-29H,7,11,14-17H2,1-6H3/t25-,27-,28?,29-,33+,34?,35?/m1/s1 |
| InChIKey | QAPFSOCCAGADQV-BTPHKOIISA-N |
| XLogP | 4.58 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.78 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|