C35H44N2O9S — CID 11468014
1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O,2-O'-diethyl 3-acetylaziridine-1,2,2-tricarboxylate (PubChem CID 11468014) has the molecular formula C35H44N2O9S and a molecular weight of 668.81 g/mol. Its IUPAC name is 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O,2-O'-diethyl 3-acetylaziridine-1,2,2-tricarboxylate.
| Compound Name | 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O,2-O'-diethyl 3-acetylaziridine-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 11468014 |
| Molecular Formula | C35H44N2O9S |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | 1-O-[(1R,2S,3R,4S)-3-[N-(benzenesulfonyl)-3,5-dimethylanilino]-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-O,2-O'-diethyl 3-acetylaziridine-1,2,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C(C)=O)N1C(=O)O[C@@H]1[C@H](N(c2cc(C)cc(C)c2)S(=O)(=O)c2ccccc2)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C35H44N2O9S/c1-9-44-30(39)35(31(40)45-10-2)28(23(5)38)36(35)32(41)46-29-27(26-16-17-34(29,8)33(26,6)7)37(24-19-21(3)18-22(4)20-24)47(42,43)25-14-12-11-13-15-25/h11-15,18-20,26-29H,9-10,16-17H2,1-8H3/t26-,27-,28?,29-,34+,36?/m1/s1 |
| InChIKey | HJTIZXUMPUKFDO-AMKZJFSOSA-N |
| XLogP | 4.97 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|