C11H12Cl4O2 — CID 10041557
(1S,2S,3S,4S,5S,6S,7S,8R)-3,4,5,6-tetrachloro-10,10-dimethyl-9,11-dioxatetracyclo[6.3.0.02,5.04,7]undecane (PubChem CID 10041557) has the molecular formula C11H12Cl4O2 and a molecular weight of 318.03 g/mol. Its IUPAC name is (1S,2S,3S,4S,5S,6S,7S,8R)-3,4,5,6-tetrachloro-10,10-dimethyl-9,11-dioxatetracyclo[6.3.0.02,5.04,7]undecane.
| Compound Name | (1S,2S,3S,4S,5S,6S,7S,8R)-3,4,5,6-tetrachloro-10,10-dimethyl-9,11-dioxatetracyclo[6.3.0.02,5.04,7]undecane |
|---|---|
| PubChem CID | 10041557 |
| Molecular Formula | C11H12Cl4O2 |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | (1S,2S,3S,4S,5S,6S,7S,8R)-3,4,5,6-tetrachloro-10,10-dimethyl-9,11-dioxatetracyclo[6.3.0.02,5.04,7]undecane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1[C@H](Cl)[C@@]3(Cl)[C@@H]2[C@H](Cl)[C@@]13Cl |
| InChI | InChI=1S/C11H12Cl4O2/c1-9(2)16-5-3-7(12)11(15)4(6(5)17-9)8(13)10(3,11)14/h3-8H,1-2H3/t3-,4-,5-,6+,7-,8-,10-,11-/m0/s1 |
| InChIKey | GRXNOVGOCZTHOS-ADFVKROFSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|