About 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid
2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 100514734) has the molecular formula C16H15Cl2N3O5S
and a molecular weight of 432.29 g/mol. Its IUPAC name is 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid |
| PubChem CID | 100514734 |
| Molecular Formula | C16H15Cl2N3O5S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc([C@@H]2CCCN(S(=O)(=O)c3cc(Cl)ccc3Cl)C2)[nH]c1=O |
| InChI | InChI=1S/C16H15Cl2N3O5S/c17-10-3-4-12(18)13(6-10)27(25,26)21-5-1-2-9(8-21)14-19-7-11(16(23)24)15(22)20-14/h3-4,6-7,9H,1-2,5,8H2,(H,23,24)(H,19,20,22)/t9-/m1/s1 |
| InChIKey | DTOWPCVYCAZTFG-SECBINFHSA-N |
| XLogP | 2.34 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid?
The IUPAC name of 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid (CID 100514734) is 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid is O=C(O)c1cnc([C@@H]2CCCN(S(=O)(=O)c3cc(Cl)ccc3Cl)C2)[nH]c1=O.
What is the InChIKey of 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid?
The InChIKey is DTOWPCVYCAZTFG-SECBINFHSA-N. The full InChI is InChI=1S/C16H15Cl2N3O5S/c17-10-3-4-12(18)13(6-10)27(25,26)21-5-1-2-9(8-21)14-19-7-11(16(23)24)15(22)20-14/h3-4,6-7,9H,1-2,5,8H2,(H,23,24)(H,19,20,22)/t9-/m1/s1.
What are the key properties of 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid?
2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid has a molecular weight of 432.29 g/mol, XLogP of 2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]-6-oxo-1H-pyrimidine-5-carboxylic acid is sourced from PubChem (CID 100514734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).