C19H24N4S — CID 100522733
(4R,5S)-1-cyclopentyl-5-(2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100522733) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is (4R,5S)-1-cyclopentyl-5-(2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-cyclopentyl-5-(2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100522733 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (4R,5S)-1-cyclopentyl-5-(2,5-dimethyl-1H-pyrrol-3-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@H]2[C@H](c3ccccn3)NC(=S)N2C2CCCC2)c(C)[nH]1 |
| InChI | InChI=1S/C19H24N4S/c1-12-11-15(13(2)21-12)18-17(16-9-5-6-10-20-16)22-19(24)23(18)14-7-3-4-8-14/h5-6,9-11,14,17-18,21H,3-4,7-8H2,1-2H3,(H,22,24)/t17-,18-/m0/s1 |
| InChIKey | RHUKXHUWFNMWIH-ROUUACIJSA-N |
| XLogP | 3.94 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|