C25H35FN6O7 — CID 10053292
(2R,3R,4S,5S,6R)-2-[8-[2-amino-6-[(2-fluoro-4-pyridinyl)methoxy]purin-9-yl]octoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10053292) has the molecular formula C25H35FN6O7 and a molecular weight of 550.59 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[8-[2-amino-6-[(2-fluoro-4-pyridinyl)methoxy]purin-9-yl]octoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[8-[2-amino-6-[(2-fluoro-4-pyridinyl)methoxy]purin-9-yl]octoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10053292 |
| Molecular Formula | C25H35FN6O7 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[8-[2-amino-6-[(2-fluoro-4-pyridinyl)methoxy]purin-9-yl]octoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1nc(OCc2ccnc(F)c2)c2ncn(CCCCCCCCO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C25H35FN6O7/c26-17-11-15(7-8-28-17)13-38-23-18-22(30-25(27)31-23)32(14-29-18)9-5-3-1-2-4-6-10-37-24-21(36)20(35)19(34)16(12-33)39-24/h7-8,11,14,16,19-21,24,33-36H,1-6,9-10,12-13H2,(H2,27,30,31)/t16-,19-,20+,21-,24-/m1/s1 |
| InChIKey | SNKSFHNMYOLLJS-OREFEKLXSA-N |
| XLogP | 0.68 |
| TPSA | 191.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|