C17H14N6 — CID 10063481
3-benzyl-5-phenyltriazolo[4,5-d]pyrimidin-7-amine (PubChem CID 10063481) has the molecular formula C17H14N6 and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-benzyl-5-phenyltriazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-benzyl-5-phenyltriazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 10063481 |
| Molecular Formula | C17H14N6 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-benzyl-5-phenyltriazolo[4,5-d]pyrimidin-7-amine |
| SMILES | Nc1nc(-c2ccccc2)nc2c1nnn2Cc1ccccc1 |
| InChI | InChI=1S/C17H14N6/c18-15-14-17(20-16(19-15)13-9-5-2-6-10-13)23(22-21-14)11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,18,19,20) |
| InChIKey | MYSWGJASKRUDKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |