C15H15NO5 — CID 100660563
3-(1,3-benzodioxol-5-yl)-N-[[(3R)-3-hydroxyoxolan-3-yl]methyl]prop-2-ynamide (PubChem CID 100660563) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[[(3R)-3-hydroxyoxolan-3-yl]methyl]prop-2-ynamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[[(3R)-3-hydroxyoxolan-3-yl]methyl]prop-2-ynamide |
|---|---|
| PubChem CID | 100660563 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[[(3R)-3-hydroxyoxolan-3-yl]methyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc2c(c1)OCO2)NC[C@]1(O)CCOC1 |
| InChI | InChI=1S/C15H15NO5/c17-14(16-8-15(18)5-6-19-9-15)4-2-11-1-3-12-13(7-11)21-10-20-12/h1,3,7,18H,5-6,8-10H2,(H,16,17)/t15-/m1/s1 |
| InChIKey | ARUPNMRFWXYVOS-OAHLLOKOSA-N |
| XLogP | 0.03 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|