C26H25F2N3O2 — CID 100670957
(2R)-N-benzyl-2-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-phenylacetamide (PubChem CID 100670957) has the molecular formula C26H25F2N3O2 and a molecular weight of 449.50 g/mol. Its IUPAC name is (2R)-N-benzyl-2-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-phenylacetamide.
| Compound Name | (2R)-N-benzyl-2-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 100670957 |
| Molecular Formula | C26H25F2N3O2 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (2R)-N-benzyl-2-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-2-phenylacetamide |
| SMILES | O=C(NCc1ccccc1)[C@@H](c1ccccc1)N1CCN(C(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C26H25F2N3O2/c27-21-12-7-13-22(28)23(21)26(33)31-16-14-30(15-17-31)24(20-10-5-2-6-11-20)25(32)29-18-19-8-3-1-4-9-19/h1-13,24H,14-18H2,(H,29,32)/t24-/m1/s1 |
| InChIKey | FEIVBKUKTJNIIF-XMMPIXPASA-N |
| XLogP | 3.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |