C27H42O7 — CID 10073806
(1R,7E,9R,12S,13E,15S,17S)-1,9,17-trihydroxy-8,10,10,12,14-pentamethyl-5-[(E)-pent-3-enyl]-4,19-dioxabicyclo[13.3.1]nonadeca-7,13-diene-3,11-dione (PubChem CID 10073806) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is (1R,7E,9R,12S,13E,15S,17S)-1,9,17-trihydroxy-8,10,10,12,14-pentamethyl-5-[(E)-pent-3-enyl]-4,19-dioxabicyclo[13.3.1]nonadeca-7,13-diene-3,11-dione.
| Compound Name | (1R,7E,9R,12S,13E,15S,17S)-1,9,17-trihydroxy-8,10,10,12,14-pentamethyl-5-[(E)-pent-3-enyl]-4,19-dioxabicyclo[13.3.1]nonadeca-7,13-diene-3,11-dione |
|---|---|
| PubChem CID | 10073806 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (1R,7E,9R,12S,13E,15S,17S)-1,9,17-trihydroxy-8,10,10,12,14-pentamethyl-5-[(E)-pent-3-enyl]-4,19-dioxabicyclo[13.3.1]nonadeca-7,13-diene-3,11-dione |
| SMILES | C/C=C/CCC1C/C=C(\C)[C@@H](O)C(C)(C)C(=O)[C@@H](C)/C=C(\C)[C@@H]2C[C@H](O)C[C@](O)(CC(=O)O1)O2 |
| InChI | InChI=1S/C27H42O7/c1-7-8-9-10-21-12-11-17(2)24(30)26(5,6)25(31)19(4)13-18(3)22-14-20(28)15-27(32,34-22)16-23(29)33-21/h7-8,11,13,19-22,24,28,30,32H,9-10,12,14-16H2,1-6H3/b8-7+,17-11+,18-13+/t19-,20-,21?,22-,24+,27+/m0/s1 |
| InChIKey | SLWJHRCOUPNNFJ-YRLQNJFESA-N |
| XLogP | 3.76 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|