About (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide
(3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide (PubChem CID 100744576) has the molecular formula C13H16F4N2O2S
and a molecular weight of 340.34 g/mol. Its IUPAC name is (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide |
| PubChem CID | 100744576 |
| Molecular Formula | C13H16F4N2O2S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC[C@@](F)(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H16F4N2O2S/c1-18(2)22(20,21)19-7-6-12(14,9-19)10-4-3-5-11(8-10)13(15,16)17/h3-5,8H,6-7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | SVBRNKSOBVUQTP-LBPRGKRZSA-N |
| XLogP | 2.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide?
The IUPAC name of (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide (CID 100744576) is (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide.
What is the SMILES notation for (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide?
The canonical SMILES for (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide is CN(C)S(=O)(=O)N1CC[C@@](F)(c2cccc(C(F)(F)F)c2)C1.
What is the InChIKey of (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide?
The InChIKey is SVBRNKSOBVUQTP-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H16F4N2O2S/c1-18(2)22(20,21)19-7-6-12(14,9-19)10-4-3-5-11(8-10)13(15,16)17/h3-5,8H,6-7,9H2,1-2H3/t12-/m0/s1.
What are the key properties of (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide?
(3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide has a molecular weight of 340.34 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-fluoro-N,N-dimethyl-3-[3-(trifluoromethyl)phenyl]pyrrolidine-1-sulfonamide is sourced from PubChem (CID 100744576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).