C28H34N2O7S — CID 10076020
tert-butyl 1-(1-methoxy-3-methylsulfonyloxy-1-oxo-3-phenylpropan-2-yl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 10076020) has the molecular formula C28H34N2O7S and a molecular weight of 542.65 g/mol. Its IUPAC name is tert-butyl 1-(1-methoxy-3-methylsulfonyloxy-1-oxo-3-phenylpropan-2-yl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl 1-(1-methoxy-3-methylsulfonyloxy-1-oxo-3-phenylpropan-2-yl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 10076020 |
| Molecular Formula | C28H34N2O7S |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | tert-butyl 1-(1-methoxy-3-methylsulfonyloxy-1-oxo-3-phenylpropan-2-yl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | COC(=O)C(C(OS(C)(=O)=O)c1ccccc1)C1c2c(c3ccccc3n2C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34N2O7S/c1-28(2,3)36-27(32)30-17-16-20-19-14-10-11-15-21(19)29(4)23(20)24(30)22(26(31)35-5)25(37-38(6,33)34)18-12-8-7-9-13-18/h7-15,22,24-25H,16-17H2,1-6H3 |
| InChIKey | REGYGWZBNLCLQA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|