C29H34N2O9S2 — CID 11758547
tert-butyl 9-(benzenesulfonyl)-1-(1-methoxy-3-methylsulfonyloxy-1-oxopent-4-en-2-yl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate (PubChem CID 11758547) has the molecular formula C29H34N2O9S2 and a molecular weight of 618.73 g/mol. Its IUPAC name is tert-butyl 9-(benzenesulfonyl)-1-(1-methoxy-3-methylsulfonyloxy-1-oxopent-4-en-2-yl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl 9-(benzenesulfonyl)-1-(1-methoxy-3-methylsulfonyloxy-1-oxopent-4-en-2-yl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 11758547 |
| Molecular Formula | C29H34N2O9S2 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | tert-butyl 9-(benzenesulfonyl)-1-(1-methoxy-3-methylsulfonyloxy-1-oxopent-4-en-2-yl)-3,4-dihydro-1H-pyrido[3,4-b]indole-2-carboxylate |
| SMILES | C=CC(OS(C)(=O)=O)C(C(=O)OC)C1c2c(c3ccccc3n2S(=O)(=O)c2ccccc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H34N2O9S2/c1-7-23(40-41(6,34)35)24(27(32)38-5)26-25-21(17-18-30(26)28(33)39-29(2,3)4)20-15-11-12-16-22(20)31(25)42(36,37)19-13-9-8-10-14-19/h7-16,23-24,26H,1,17-18H2,2-6H3 |
| InChIKey | DWMGHSAISRVOSU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|