C19H21N5O4S2 — CID 100760555
1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea (PubChem CID 100760555) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea.
| Compound Name | 1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
|---|---|
| PubChem CID | 100760555 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 1-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[3-[methyl(methylsulfonyl)amino]phenyl]thiourea |
| SMILES | COc1ccc(-c2noc(CNC(=S)Nc3cccc(N(C)S(C)(=O)=O)c3)n2)cc1 |
| InChI | InChI=1S/C19H21N5O4S2/c1-24(30(3,25)26)15-6-4-5-14(11-15)21-19(29)20-12-17-22-18(23-28-17)13-7-9-16(27-2)10-8-13/h4-11H,12H2,1-3H3,(H2,20,21,29) |
| InChIKey | SLRYQPNMEMVEDV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|