C13H19ClN2O6S2 — CID 100768326
(2S)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]sulfonyl-3-methoxy-2-methylpropanamide (PubChem CID 100768326) has the molecular formula C13H19ClN2O6S2 and a molecular weight of 398.89 g/mol. Its IUPAC name is (2S)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]sulfonyl-3-methoxy-2-methylpropanamide.
| Compound Name | (2S)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]sulfonyl-3-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 100768326 |
| Molecular Formula | C13H19ClN2O6S2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (2S)-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]sulfonyl-3-methoxy-2-methylpropanamide |
| SMILES | COC[C@H](C)C(=O)NS(=O)(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2O6S2/c1-9(8-22-4)13(17)15-23(18,19)12-7-10(5-6-11(12)14)24(20,21)16(2)3/h5-7,9H,8H2,1-4H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | RUROHNNKJPYUOF-VIFPVBQESA-N |
| XLogP | 0.68 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |